C55H34N6O — CID 129292130
9-(4,6-diphenylpyrimidin-2-yl)-4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]carbazole (PubChem CID 129292130) has the molecular formula C55H34N6O and a molecular weight of 794.92 g/mol. Its IUPAC name is 9-(4,6-diphenylpyrimidin-2-yl)-4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]carbazole.
| Compound Name | 9-(4,6-diphenylpyrimidin-2-yl)-4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]carbazole |
|---|---|
| PubChem CID | 129292130 |
| Molecular Formula | C55H34N6O |
| Molecular Weight | 794.92 g/mol |
| Exact Mass | 794.28 |
| IUPAC Name | 9-(4,6-diphenylpyrimidin-2-yl)-4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]carbazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-n3c4ccccc4c4c(-c5ccc6oc7cccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)c7c6c5)cccc43)n2)cc1 |
| InChI | InChI=1S/C55H34N6O/c1-5-17-35(18-6-1)44-34-45(36-19-7-2-8-20-36)57-55(56-44)61-46-28-14-13-25-41(46)50-40(26-15-29-47(50)61)39-31-32-48-43(33-39)51-42(27-16-30-49(51)62-48)54-59-52(37-21-9-3-10-22-37)58-53(60-54)38-23-11-4-12-24-38/h1-34H |
| InChIKey | FSADCLNFIUBXBY-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.92 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |