C80H50N6O — CID 129292169
5-(4,6-diphenylpyrimidin-2-yl)-3-[8-[5-(4,6-diphenylpyrimidin-2-yl)-9-phenylcarbazol-3-yl]dibenzofuran-2-yl]-9-phenylcarbazole (PubChem CID 129292169) has the molecular formula C80H50N6O and a molecular weight of 1111.32 g/mol. Its IUPAC name is 5-(4,6-diphenylpyrimidin-2-yl)-3-[8-[5-(4,6-diphenylpyrimidin-2-yl)-9-phenylcarbazol-3-yl]dibenzofuran-2-yl]-9-phenylcarbazole.
| Compound Name | 5-(4,6-diphenylpyrimidin-2-yl)-3-[8-[5-(4,6-diphenylpyrimidin-2-yl)-9-phenylcarbazol-3-yl]dibenzofuran-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 129292169 |
| Molecular Formula | C80H50N6O |
| Molecular Weight | 1111.32 g/mol |
| Exact Mass | 1110.40 |
| IUPAC Name | 5-(4,6-diphenylpyrimidin-2-yl)-3-[8-[5-(4,6-diphenylpyrimidin-2-yl)-9-phenylcarbazol-3-yl]dibenzofuran-2-yl]-9-phenylcarbazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cccc4c3c3cc(-c5ccc6oc7ccc(-c8ccc9c(c8)c8c(-c%10nc(-c%11ccccc%11)cc(-c%11ccccc%11)n%10)cccc8n9-c8ccccc8)cc7c6c5)ccc3n4-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C80H50N6O/c1-7-21-51(22-8-1)67-49-68(52-23-9-2-10-24-52)82-79(81-67)61-33-19-35-73-77(61)65-47-55(37-41-71(65)85(73)59-29-15-5-16-30-59)57-39-43-75-63(45-57)64-46-58(40-44-76(64)87-75)56-38-42-72-66(48-56)78-62(34-20-36-74(78)86(72)60-31-17-6-18-32-60)80-83-69(53-25-11-3-12-26-53)50-70(84-80)54-27-13-4-14-28-54/h1-50H |
| InChIKey | DYRBAJCUUBAFDM-UHFFFAOYSA-N |
| XLogP | 20.70 |
| TPSA | 74.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1111.32 |
| LogP ≤ 5 | 20.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |