C33H39N3 — CID 129292325
2,6-bis[6-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-2-pyridinyl]pyridine (PubChem CID 129292325) has the molecular formula C33H39N3 and a molecular weight of 477.70 g/mol. Its IUPAC name is 2,6-bis[6-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-2-pyridinyl]pyridine.
| Compound Name | 2,6-bis[6-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 129292325 |
| Molecular Formula | C33H39N3 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 2,6-bis[6-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-2-pyridinyl]pyridine |
| SMILES | CC1(C)[C@H]2CCC(c3cccc(-c4cccc(-c5cccc(C6CC[C@H]7C[C@@H]6C7(C)C)n5)n4)n3)[C@@H]1C2 |
| InChI | InChI=1S/C33H39N3/c1-32(2)20-14-16-22(24(32)18-20)26-8-5-10-28(34-26)30-12-7-13-31(36-30)29-11-6-9-27(35-29)23-17-15-21-19-25(23)33(21,3)4/h5-13,20-25H,14-19H2,1-4H3/t20-,21-,22?,23?,24-,25-/m0/s1 |
| InChIKey | XVNCKWOUBKJTHM-JUAFVAOLSA-N |
| XLogP | 8.28 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |