About 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione
7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione (PubChem CID 129292745) has the molecular formula C15H13ClN2O4
and a molecular weight of 320.73 g/mol. Its IUPAC name is 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione |
| PubChem CID | 129292745 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)COc1cc2oc3nc(=O)[nH]c(=O)c-3cc2cc1Cl |
| InChI | InChI=1S/C15H13ClN2O4/c1-7(2)6-21-12-5-11-8(4-10(12)16)3-9-13(19)17-15(20)18-14(9)22-11/h3-5,7H,6H2,1-2H3,(H,17,19,20) |
| InChIKey | ADBDKMJPIOTSDJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione?
The IUPAC name of 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione (CID 129292745) is 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione.
What is the SMILES notation for 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione?
The canonical SMILES for 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione is CC(C)COc1cc2oc3nc(=O)[nH]c(=O)c-3cc2cc1Cl.
What is the InChIKey of 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione?
The InChIKey is ADBDKMJPIOTSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN2O4/c1-7(2)6-21-12-5-11-8(4-10(12)16)3-9-13(19)17-15(20)18-14(9)22-11/h3-5,7H,6H2,1-2H3,(H,17,19,20).
What are the key properties of 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione?
7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione has a molecular weight of 320.73 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-8-(2-methylpropoxy)chromeno[2,3-d]pyrimidine-2,4-dione is sourced from PubChem (CID 129292745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).