About 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole
3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (PubChem CID 129293099) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole |
| PubChem CID | 129293099 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole |
| SMILES | CCOc1nn2c(c1C(C)(C)C)CCC2 |
| InChI | InChI=1S/C12H20N2O/c1-5-15-11-10(12(2,3)4)9-7-6-8-14(9)13-11/h5-8H2,1-4H3 |
| InChIKey | VOYPNAQMXIALDM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The IUPAC name of 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (CID 129293099) is 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole.
What is the SMILES notation for 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The canonical SMILES for 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is CCOc1nn2c(c1C(C)(C)C)CCC2.
What is the InChIKey of 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The InChIKey is VOYPNAQMXIALDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-5-15-11-10(12(2,3)4)9-7-6-8-14(9)13-11/h5-8H2,1-4H3.
What are the key properties of 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole has a molecular weight of 208.30 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2-ethoxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is sourced from PubChem (CID 129293099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).