About 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine
1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine (PubChem CID 129293802) has the molecular formula C24H45N
and a molecular weight of 347.63 g/mol. Its IUPAC name is 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine.
Molecular Properties
| Compound Name | 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine |
| PubChem CID | 129293802 |
| Molecular Formula | C24H45N |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 347.36 |
| IUPAC Name | 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine |
| SMILES | C=C=C(CCCCCCCCCCCCCC)N1CCC(CCC)C1 |
| InChI | InChI=1S/C24H45N/c1-4-7-8-9-10-11-12-13-14-15-16-17-19-24(6-3)25-21-20-23(22-25)18-5-2/h23H,3-5,7-22H2,1-2H3 |
| InChIKey | NJZUJUPBRPXXCA-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine?
The IUPAC name of 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine (CID 129293802) is 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine.
What is the SMILES notation for 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine?
The canonical SMILES for 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine is C=C=C(CCCCCCCCCCCCCC)N1CCC(CCC)C1.
What is the InChIKey of 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine?
The InChIKey is NJZUJUPBRPXXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H45N/c1-4-7-8-9-10-11-12-13-14-15-16-17-19-24(6-3)25-21-20-23(22-25)18-5-2/h23H,3-5,7-22H2,1-2H3.
What are the key properties of 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine?
1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine has a molecular weight of 347.63 g/mol, XLogP of 7.87, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptadeca-1,2-dien-3-yl-3-propylpyrrolidine is sourced from PubChem (CID 129293802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).