C10H18FN — CID 129294277
(4Z,6Z)-3-fluoro-2,6-dimethylocta-4,6-dien-2-amine (PubChem CID 129294277) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is (4Z,6Z)-3-fluoro-2,6-dimethylocta-4,6-dien-2-amine.
| Compound Name | (4Z,6Z)-3-fluoro-2,6-dimethylocta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 129294277 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (4Z,6Z)-3-fluoro-2,6-dimethylocta-4,6-dien-2-amine |
| SMILES | C/C=C(C)\C=C/C(F)C(C)(C)N |
| InChI | InChI=1S/C10H18FN/c1-5-8(2)6-7-9(11)10(3,4)12/h5-7,9H,12H2,1-4H3/b7-6-,8-5- |
| InChIKey | HZKJZLDHZFTGPG-HSHIGALWSA-N |
| XLogP | 2.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|