About N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine
N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine (PubChem CID 129294383) has the molecular formula C9H15F3N4
and a molecular weight of 236.24 g/mol. Its IUPAC name is N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine.
Molecular Properties
| Compound Name | N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine |
| PubChem CID | 129294383 |
| Molecular Formula | C9H15F3N4 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine |
| SMILES | CCCCNCNc1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C9H15F3N4/c1-2-3-4-13-6-14-8-5-7(15-16-8)9(10,11)12/h5,13H,2-4,6H2,1H3,(H2,14,15,16) |
| InChIKey | NSXSIFZMCBWCNT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine?
The IUPAC name of N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine (CID 129294383) is N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine.
What is the SMILES notation for N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine?
The canonical SMILES for N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine is CCCCNCNc1cc(C(F)(F)F)[nH]n1.
What is the InChIKey of N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine?
The InChIKey is NSXSIFZMCBWCNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N4/c1-2-3-4-13-6-14-8-5-7(15-16-8)9(10,11)12/h5,13H,2-4,6H2,1H3,(H2,14,15,16).
What are the key properties of N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine?
N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine has a molecular weight of 236.24 g/mol, XLogP of 2.19, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanediamine is sourced from PubChem (CID 129294383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).