C12H19NO — CID 129294484
4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxypiperidine (PubChem CID 129294484) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxypiperidine.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxypiperidine |
|---|---|
| PubChem CID | 129294484 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxypiperidine |
| SMILES | C=C/C(=C\C=C/C)OC1CCNCC1 |
| InChI | InChI=1S/C12H19NO/c1-3-5-6-11(4-2)14-12-7-9-13-10-8-12/h3-6,12-13H,2,7-10H2,1H3/b5-3-,11-6+ |
| InChIKey | WAVSXMVJYWOOKO-GGKXIICKSA-N |
| XLogP | 2.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|