About 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine
4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine (PubChem CID 129294494) has the molecular formula C29H30BrN3
and a molecular weight of 500.48 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine |
| PubChem CID | 129294494 |
| Molecular Formula | C29H30BrN3 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine |
| SMILES | CC(C)(C)c1ccnc(-c2cc(-c3ccc(Br)cc3)cc(-c3cc(C(C)(C)C)ccn3)n2)c1 |
| InChI | InChI=1S/C29H30BrN3/c1-28(2,3)21-11-13-31-24(17-21)26-15-20(19-7-9-23(30)10-8-19)16-27(33-26)25-18-22(12-14-32-25)29(4,5)6/h7-18H,1-6H3 |
| InChIKey | NUUUGIJZHWPYPS-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine?
The IUPAC name of 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine (CID 129294494) is 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine.
What is the SMILES notation for 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine?
The canonical SMILES for 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine is CC(C)(C)c1ccnc(-c2cc(-c3ccc(Br)cc3)cc(-c3cc(C(C)(C)C)ccn3)n2)c1.
What is the InChIKey of 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine?
The InChIKey is NUUUGIJZHWPYPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30BrN3/c1-28(2,3)21-11-13-31-24(17-21)26-15-20(19-7-9-23(30)10-8-19)16-27(33-26)25-18-22(12-14-32-25)29(4,5)6/h7-18H,1-6H3.
What are the key properties of 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine?
4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine has a molecular weight of 500.48 g/mol, XLogP of 8.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine is sourced from PubChem (CID 129294494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).