C5H6F7NO2S — CID 129294817
N-ethyl-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide (PubChem CID 129294817) has the molecular formula C5H6F7NO2S and a molecular weight of 277.16 g/mol. Its IUPAC name is N-ethyl-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide.
| Compound Name | N-ethyl-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 129294817 |
| Molecular Formula | C5H6F7NO2S |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | N-ethyl-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide |
| SMILES | CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H6F7NO2S/c1-2-13-16(14,15)5(11,12)3(6,7)4(8,9)10/h13H,2H2,1H3 |
| InChIKey | YLXKUKZPBUXBRV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|