C11H14F9NO2S — CID 129294877
N-(cyclohexylmethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 129294877) has the molecular formula C11H14F9NO2S and a molecular weight of 395.29 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N-(cyclohexylmethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 129294877 |
| Molecular Formula | C11H14F9NO2S |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N-(cyclohexylmethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(NCC1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F9NO2S/c12-8(13,10(16,17)18)9(14,15)11(19,20)24(22,23)21-6-7-4-2-1-3-5-7/h7,21H,1-6H2 |
| InChIKey | XPYBJJYBIMZERS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|