C10H14F7NO2S — CID 129294878
N-(cyclohexylmethyl)-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide (PubChem CID 129294878) has the molecular formula C10H14F7NO2S and a molecular weight of 345.28 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide.
| Compound Name | N-(cyclohexylmethyl)-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 129294878 |
| Molecular Formula | C10H14F7NO2S |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-(cyclohexylmethyl)-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide |
| SMILES | O=S(=O)(NCC1CCCCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F7NO2S/c11-8(12,9(13,14)15)10(16,17)21(19,20)18-6-7-4-2-1-3-5-7/h7,18H,1-6H2 |
| InChIKey | MOKWKHBBTHESNL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|