C8H10F7NO2S — CID 129294963
N-cyclopentyl-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide (PubChem CID 129294963) has the molecular formula C8H10F7NO2S and a molecular weight of 317.23 g/mol. Its IUPAC name is N-cyclopentyl-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide.
| Compound Name | N-cyclopentyl-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 129294963 |
| Molecular Formula | C8H10F7NO2S |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | N-cyclopentyl-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F7NO2S/c9-6(10,7(11,12)13)8(14,15)19(17,18)16-5-3-1-2-4-5/h5,16H,1-4H2 |
| InChIKey | DPXFHXNHBCGVGS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|