C7H10F5NO2S — CID 129294967
N-cyclopentyl-1,1,2,2,2-pentafluoroethanesulfonamide (PubChem CID 129294967) has the molecular formula C7H10F5NO2S and a molecular weight of 267.22 g/mol. Its IUPAC name is N-cyclopentyl-1,1,2,2,2-pentafluoroethanesulfonamide.
| Compound Name | N-cyclopentyl-1,1,2,2,2-pentafluoroethanesulfonamide |
|---|---|
| PubChem CID | 129294967 |
| Molecular Formula | C7H10F5NO2S |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N-cyclopentyl-1,1,2,2,2-pentafluoroethanesulfonamide |
| SMILES | O=S(=O)(NC1CCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F5NO2S/c8-6(9,10)7(11,12)16(14,15)13-5-3-1-2-4-5/h5,13H,1-4H2 |
| InChIKey | KYQYHRYMIHCBAY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|