C6H8IN3 — CID 129294970
2-iodo-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 129294970) has the molecular formula C6H8IN3 and a molecular weight of 249.05 g/mol. Its IUPAC name is 2-iodo-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 2-iodo-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 129294970 |
| Molecular Formula | C6H8IN3 |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 2-iodo-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | In1cc2c(n1)CCNC2 |
| InChI | InChI=1S/C6H8IN3/c7-10-4-5-3-8-2-1-6(5)9-10/h4,8H,1-3H2 |
| InChIKey | UVYCOQIXZLLNMK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|