C9H10F9NO2S — CID 129294972
N-cyclopentyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 129294972) has the molecular formula C9H10F9NO2S and a molecular weight of 367.23 g/mol. Its IUPAC name is N-cyclopentyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N-cyclopentyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 129294972 |
| Molecular Formula | C9H10F9NO2S |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | N-cyclopentyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F9NO2S/c10-6(11,8(14,15)16)7(12,13)9(17,18)22(20,21)19-5-3-1-2-4-5/h5,19H,1-4H2 |
| InChIKey | GHSAAULZBJRIPM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|