C6H6F7NO2S — CID 129294985
1,1,2,2,3,3,3-heptafluoro-N-prop-2-enylpropane-1-sulfonamide (PubChem CID 129294985) has the molecular formula C6H6F7NO2S and a molecular weight of 289.17 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-prop-2-enylpropane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-prop-2-enylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 129294985 |
| Molecular Formula | C6H6F7NO2S |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-prop-2-enylpropane-1-sulfonamide |
| SMILES | C=CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6F7NO2S/c1-2-3-14-17(15,16)6(12,13)4(7,8)5(9,10)11/h2,14H,1,3H2 |
| InChIKey | VJIPGLPQJVIMJC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|