C7H8F7NO2S — CID 129294987
N-[(E)-but-2-enyl]-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide (PubChem CID 129294987) has the molecular formula C7H8F7NO2S and a molecular weight of 303.20 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide.
| Compound Name | N-[(E)-but-2-enyl]-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 129294987 |
| Molecular Formula | C7H8F7NO2S |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | N-[(E)-but-2-enyl]-1,1,2,2,3,3,3-heptafluoropropane-1-sulfonamide |
| SMILES | C/C=C/CNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F7NO2S/c1-2-3-4-15-18(16,17)7(13,14)5(8,9)6(10,11)12/h2-3,15H,4H2,1H3/b3-2+ |
| InChIKey | GQHIBUYSXKRVCN-NSCUHMNNSA-N |
| XLogP | 2.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|