C5H6F5NO2S — CID 129294989
1,1,2,2,2-pentafluoro-N-prop-2-enylethanesulfonamide (PubChem CID 129294989) has the molecular formula C5H6F5NO2S and a molecular weight of 239.16 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoro-N-prop-2-enylethanesulfonamide.
| Compound Name | 1,1,2,2,2-pentafluoro-N-prop-2-enylethanesulfonamide |
|---|---|
| PubChem CID | 129294989 |
| Molecular Formula | C5H6F5NO2S |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 1,1,2,2,2-pentafluoro-N-prop-2-enylethanesulfonamide |
| SMILES | C=CCNS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H6F5NO2S/c1-2-3-11-14(12,13)5(9,10)4(6,7)8/h2,11H,1,3H2 |
| InChIKey | QRDJXMKAMBKNJB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|