C6H8F5NO2S — CID 129294993
N-[(E)-but-2-enyl]-1,1,2,2,2-pentafluoroethanesulfonamide (PubChem CID 129294993) has the molecular formula C6H8F5NO2S and a molecular weight of 253.19 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-1,1,2,2,2-pentafluoroethanesulfonamide.
| Compound Name | N-[(E)-but-2-enyl]-1,1,2,2,2-pentafluoroethanesulfonamide |
|---|---|
| PubChem CID | 129294993 |
| Molecular Formula | C6H8F5NO2S |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-[(E)-but-2-enyl]-1,1,2,2,2-pentafluoroethanesulfonamide |
| SMILES | C/C=C/CNS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5NO2S/c1-2-3-4-12-15(13,14)6(10,11)5(7,8)9/h2-3,12H,4H2,1H3/b3-2+ |
| InChIKey | HKBCTXXOCSYKNH-NSCUHMNNSA-N |
| XLogP | 1.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|