C29H41N2O2+ — CID 129295172
N-(2-methoxyethyl)-2-[2-[6-[2-(2-methoxyethyl)-3,4-dihydroisoquinolin-2-ium-1-yl]hex-1-en-2-yl]phenyl]ethanamine (PubChem CID 129295172) has the molecular formula C29H41N2O2+ and a molecular weight of 449.66 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[2-[6-[2-(2-methoxyethyl)-3,4-dihydroisoquinolin-2-ium-1-yl]hex-1-en-2-yl]phenyl]ethanamine.
| Compound Name | N-(2-methoxyethyl)-2-[2-[6-[2-(2-methoxyethyl)-3,4-dihydroisoquinolin-2-ium-1-yl]hex-1-en-2-yl]phenyl]ethanamine |
|---|---|
| PubChem CID | 129295172 |
| Molecular Formula | C29H41N2O2+ |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.32 |
| IUPAC Name | N-(2-methoxyethyl)-2-[2-[6-[2-(2-methoxyethyl)-3,4-dihydroisoquinolin-2-ium-1-yl]hex-1-en-2-yl]phenyl]ethanamine |
| SMILES | C=C(CCCCC1=[N+](CCOC)CCc2ccccc21)c1ccccc1CCNCCOC |
| InChI | InChI=1S/C29H41N2O2/c1-24(27-13-7-5-11-25(27)16-18-30-19-22-32-2)10-4-9-15-29-28-14-8-6-12-26(28)17-20-31(29)21-23-33-3/h5-8,11-14,30H,1,4,9-10,15-23H2,2-3H3/q+1 |
| InChIKey | IALPWKQDTJDIFJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 33.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|