About 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane]
6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane] (PubChem CID 129295501) has the molecular formula C22H20FN3O2S
and a molecular weight of 409.49 g/mol. Its IUPAC name is 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane].
Molecular Properties
| Compound Name | 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane] |
| PubChem CID | 129295501 |
| Molecular Formula | C22H20FN3O2S |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane] |
| SMILES | CCS(=O)c1ccc2c(c1)N(c1ncc(-c3ccccc3F)cn1)CC21COC1 |
| InChI | InChI=1S/C22H20FN3O2S/c1-2-29(27)16-7-8-18-20(9-16)26(12-22(18)13-28-14-22)21-24-10-15(11-25-21)17-5-3-4-6-19(17)23/h3-11H,2,12-14H2,1H3 |
| InChIKey | UVDRHEYZUCWSFI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane]?
The IUPAC name of 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane] (CID 129295501) is 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane].
What is the SMILES notation for 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane]?
The canonical SMILES for 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane] is CCS(=O)c1ccc2c(c1)N(c1ncc(-c3ccccc3F)cn1)CC21COC1.
What is the InChIKey of 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane]?
The InChIKey is UVDRHEYZUCWSFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FN3O2S/c1-2-29(27)16-7-8-18-20(9-16)26(12-22(18)13-28-14-22)21-24-10-15(11-25-21)17-5-3-4-6-19(17)23/h3-11H,2,12-14H2,1H3.
What are the key properties of 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane]?
6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane] has a molecular weight of 409.49 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylsulfinyl-1-[5-(2-fluorophenyl)pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane] is sourced from PubChem (CID 129295501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).