About 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane
1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane (PubChem CID 12929553) has the molecular formula C11H22O2Si
and a molecular weight of 214.38 g/mol. Its IUPAC name is 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane.
Molecular Properties
| Compound Name | 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane |
| PubChem CID | 12929553 |
| Molecular Formula | C11H22O2Si |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane |
| SMILES | CC=C=C(OC(C)OCC)[Si](C)(C)C |
| InChI | InChI=1S/C11H22O2Si/c1-7-9-11(14(4,5)6)13-10(3)12-8-2/h7,10H,8H2,1-6H3 |
| InChIKey | ZDHIMWZYGJAOFC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane?
The IUPAC name of 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane (CID 12929553) is 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane.
What is the SMILES notation for 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane?
The canonical SMILES for 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane is CC=C=C(OC(C)OCC)[Si](C)(C)C.
What is the InChIKey of 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane?
The InChIKey is ZDHIMWZYGJAOFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2Si/c1-7-9-11(14(4,5)6)13-10(3)12-8-2/h7,10H,8H2,1-6H3.
What are the key properties of 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane?
1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane has a molecular weight of 214.38 g/mol, XLogP of 3.32, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethoxyethoxy)buta-1,2-dienyl-trimethylsilane is sourced from PubChem (CID 12929553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).