About tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane
tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane (PubChem CID 12929561) has the molecular formula C14H28O2SeSi
and a molecular weight of 335.42 g/mol. Its IUPAC name is tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane |
| PubChem CID | 12929561 |
| Molecular Formula | C14H28O2SeSi |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane |
| SMILES | CCOC(C)OC(=C=C[Se]C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2SeSi/c1-9-15-12(2)16-13(10-11-17-6)18(7,8)14(3,4)5/h11-12H,9H2,1-8H3 |
| InChIKey | OACYYZBSYFBFCO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane?
The IUPAC name of tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane (CID 12929561) is tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane.
What is the SMILES notation for tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane?
The canonical SMILES for tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane is CCOC(C)OC(=C=C[Se]C)[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane?
The InChIKey is OACYYZBSYFBFCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2SeSi/c1-9-15-12(2)16-13(10-11-17-6)18(7,8)14(3,4)5/h11-12H,9H2,1-8H3.
What are the key properties of tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane?
tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane has a molecular weight of 335.42 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[1-(1-ethoxyethoxy)-3-methylselanylpropa-1,2-dienyl]-dimethylsilane is sourced from PubChem (CID 12929561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).