C22H15F4N3O3 — CID 129295648
1-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane]-6-carbaldehyde (PubChem CID 129295648) has the molecular formula C22H15F4N3O3 and a molecular weight of 445.37 g/mol. Its IUPAC name is 1-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane]-6-carbaldehyde.
| Compound Name | 1-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane]-6-carbaldehyde |
|---|---|
| PubChem CID | 129295648 |
| Molecular Formula | C22H15F4N3O3 |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-[5-[2-fluoro-5-(trifluoromethoxy)phenyl]pyrimidin-2-yl]spiro[2H-indole-3,3'-oxetane]-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)N(c1ncc(-c3cc(OC(F)(F)F)ccc3F)cn1)CC21COC1 |
| InChI | InChI=1S/C22H15F4N3O3/c23-18-4-2-15(32-22(24,25)26)6-16(18)14-7-27-20(28-8-14)29-10-21(11-31-12-21)17-3-1-13(9-30)5-19(17)29/h1-9H,10-12H2 |
| InChIKey | CKOCPNZRNZNXTL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|