About (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal
(8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal (PubChem CID 129295690) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal.
Molecular Properties
| Compound Name | (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal |
| PubChem CID | 129295690 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal |
| SMILES | CO/C=C(C)/C=C(\C=C(C)C)C(=O)CCCCCC=O |
| InChI | InChI=1S/C17H26O3/c1-14(2)11-16(12-15(3)13-20-4)17(19)9-7-5-6-8-10-18/h10-13H,5-9H2,1-4H3/b15-13+,16-12+ |
| InChIKey | OFYHIYHTEYAINR-HVCKESBWSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal?
The IUPAC name of (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal (CID 129295690) is (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal.
What is the SMILES notation for (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal?
The canonical SMILES for (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal is CO/C=C(C)/C=C(\C=C(C)C)C(=O)CCCCCC=O.
What is the InChIKey of (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal?
The InChIKey is OFYHIYHTEYAINR-HVCKESBWSA-N. The full InChI is InChI=1S/C17H26O3/c1-14(2)11-16(12-15(3)13-20-4)17(19)9-7-5-6-8-10-18/h10-13H,5-9H2,1-4H3/b15-13+,16-12+.
What are the key properties of (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal?
(8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal has a molecular weight of 278.39 g/mol, XLogP of 4.15, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8E,10E)-11-methoxy-10-methyl-8-(2-methylprop-1-enyl)-7-oxoundeca-8,10-dienal is sourced from PubChem (CID 129295690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).