About 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine
1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine (PubChem CID 129295757) has the molecular formula C18H31NO
and a molecular weight of 277.45 g/mol. Its IUPAC name is 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine |
| PubChem CID | 129295757 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine |
| SMILES | C=C(/C=C\C(=C/C)OCCCC)CCCN1CCCC1 |
| InChI | InChI=1S/C18H31NO/c1-4-6-16-20-18(5-2)12-11-17(3)10-9-15-19-13-7-8-14-19/h5,11-12H,3-4,6-10,13-16H2,1-2H3/b12-11-,18-5+ |
| InChIKey | OLPJZSHGUYSIEG-LVCHWIMMSA-N |
| XLogP | 4.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine?
The IUPAC name of 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine (CID 129295757) is 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine.
What is the SMILES notation for 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine?
The canonical SMILES for 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine is C=C(/C=C\C(=C/C)OCCCC)CCCN1CCCC1.
What is the InChIKey of 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine?
The InChIKey is OLPJZSHGUYSIEG-LVCHWIMMSA-N. The full InChI is InChI=1S/C18H31NO/c1-4-6-16-20-18(5-2)12-11-17(3)10-9-15-19-13-7-8-14-19/h5,11-12H,3-4,6-10,13-16H2,1-2H3/b12-11-,18-5+.
What are the key properties of 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine?
1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine has a molecular weight of 277.45 g/mol, XLogP of 4.70, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5Z,7E)-7-butoxy-4-methylidenenona-5,7-dienyl]pyrrolidine is sourced from PubChem (CID 129295757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).