About 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal
4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal (PubChem CID 129295796) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal.
Molecular Properties
| Compound Name | 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal |
| PubChem CID | 129295796 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal |
| SMILES | CCC1=CC(OC)CC=C1OCCCC=O |
| InChI | InChI=1S/C13H20O3/c1-3-11-10-12(15-2)6-7-13(11)16-9-5-4-8-14/h7-8,10,12H,3-6,9H2,1-2H3 |
| InChIKey | LPGQXTQEJZKIMW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal?
The IUPAC name of 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal (CID 129295796) is 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal.
What is the SMILES notation for 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal?
The canonical SMILES for 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal is CCC1=CC(OC)CC=C1OCCCC=O.
What is the InChIKey of 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal?
The InChIKey is LPGQXTQEJZKIMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-3-11-10-12(15-2)6-7-13(11)16-9-5-4-8-14/h7-8,10,12H,3-6,9H2,1-2H3.
What are the key properties of 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal?
4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal has a molecular weight of 224.30 g/mol, XLogP of 2.62, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-ethyl-4-methoxycyclohexa-1,5-dien-1-yl)oxybutanal is sourced from PubChem (CID 129295796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).