About 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal
3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal (PubChem CID 129295974) has the molecular formula C11H13FO2
and a molecular weight of 196.22 g/mol. Its IUPAC name is 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal.
Molecular Properties
| Compound Name | 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal |
| PubChem CID | 129295974 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal |
| SMILES | O=CCCOC1=CC=C(CF)CC=C1 |
| InChI | InChI=1S/C11H13FO2/c12-9-10-3-1-4-11(6-5-10)14-8-2-7-13/h1,4-7H,2-3,8-9H2 |
| InChIKey | HEEFJQKBSCNIMV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal?
The IUPAC name of 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal (CID 129295974) is 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal.
What is the SMILES notation for 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal?
The canonical SMILES for 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal is O=CCCOC1=CC=C(CF)CC=C1.
What is the InChIKey of 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal?
The InChIKey is HEEFJQKBSCNIMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO2/c12-9-10-3-1-4-11(6-5-10)14-8-2-7-13/h1,4-7H,2-3,8-9H2.
What are the key properties of 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal?
3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal has a molecular weight of 196.22 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(fluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxypropanal is sourced from PubChem (CID 129295974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).