C17H30N2O2 — CID 129296016
(E)-1-N-butyl-2-N-methyl-5-[6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-dioxin-5-yl]pent-4-ene-1,2-diamine (PubChem CID 129296016) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (E)-1-N-butyl-2-N-methyl-5-[6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-dioxin-5-yl]pent-4-ene-1,2-diamine.
| Compound Name | (E)-1-N-butyl-2-N-methyl-5-[6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-dioxin-5-yl]pent-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 129296016 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | (E)-1-N-butyl-2-N-methyl-5-[6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-dioxin-5-yl]pent-4-ene-1,2-diamine |
| SMILES | C/C=C\C1=C(/C=C/CC(CNCCCC)NC)OCCO1 |
| InChI | InChI=1S/C17H30N2O2/c1-4-6-11-19-14-15(18-3)9-7-10-17-16(8-5-2)20-12-13-21-17/h5,7-8,10,15,18-19H,4,6,9,11-14H2,1-3H3/b8-5-,10-7+ |
| InChIKey | XCKSBIAPZFMWNP-OEPUHGBTSA-N |
| XLogP | 2.74 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|