About (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one
(3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one (PubChem CID 129296017) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one.
Molecular Properties
| Compound Name | (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one |
| PubChem CID | 129296017 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one |
| SMILES | C=C(OC)/C(C)=C\C(=C/CC)C(=O)CCCCC |
| InChI | InChI=1S/C16H26O2/c1-6-8-9-11-16(17)15(10-7-2)12-13(3)14(4)18-5/h10,12H,4,6-9,11H2,1-3,5H3/b13-12-,15-10+ |
| InChIKey | ZYPAHEVYTNLIMK-LSBJMZBQSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one?
The IUPAC name of (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one (CID 129296017) is (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one.
What is the SMILES notation for (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one?
The canonical SMILES for (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one is C=C(OC)/C(C)=C\C(=C/CC)C(=O)CCCCC.
What is the InChIKey of (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one?
The InChIKey is ZYPAHEVYTNLIMK-LSBJMZBQSA-N. The full InChI is InChI=1S/C16H26O2/c1-6-8-9-11-16(17)15(10-7-2)12-13(3)14(4)18-5/h10,12H,4,6-9,11H2,1-3,5H3/b13-12-,15-10+.
What are the key properties of (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one?
(3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one has a molecular weight of 250.38 g/mol, XLogP of 4.58, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-2-methoxy-3-methyl-5-propylideneundeca-1,3-dien-6-one is sourced from PubChem (CID 129296017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).