About 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal
3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal (PubChem CID 129296054) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal.
Molecular Properties
| Compound Name | 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal |
| PubChem CID | 129296054 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal |
| SMILES | COC1C=CC=C(CCC=O)C=C1 |
| InChI | InChI=1S/C11H14O2/c1-13-11-6-2-4-10(7-8-11)5-3-9-12/h2,4,6-9,11H,3,5H2,1H3 |
| InChIKey | PMUQNGGWKMNXMJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal?
The IUPAC name of 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal (CID 129296054) is 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal.
What is the SMILES notation for 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal?
The canonical SMILES for 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal is COC1C=CC=C(CCC=O)C=C1.
What is the InChIKey of 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal?
The InChIKey is PMUQNGGWKMNXMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-13-11-6-2-4-10(7-8-11)5-3-9-12/h2,4,6-9,11H,3,5H2,1H3.
What are the key properties of 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal?
3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal has a molecular weight of 178.23 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methoxycyclohepta-1,3,6-trien-1-yl)propanal is sourced from PubChem (CID 129296054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).