C19H22N2O — CID 129296297
2-(5H-imidazo[5,1-a]isoindol-5-yl)-2,6,6-trimethylcyclohexan-1-one (PubChem CID 129296297) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(5H-imidazo[5,1-a]isoindol-5-yl)-2,6,6-trimethylcyclohexan-1-one.
| Compound Name | 2-(5H-imidazo[5,1-a]isoindol-5-yl)-2,6,6-trimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 129296297 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(5H-imidazo[5,1-a]isoindol-5-yl)-2,6,6-trimethylcyclohexan-1-one |
| SMILES | CC1(C)CCCC(C)(C2c3ccccc3-c3cncn32)C1=O |
| InChI | InChI=1S/C19H22N2O/c1-18(2)9-6-10-19(3,17(18)22)16-14-8-5-4-7-13(14)15-11-20-12-21(15)16/h4-5,7-8,11-12,16H,6,9-10H2,1-3H3 |
| InChIKey | YWZXZCGPQDQHIH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |