C9H12N2O2 — CID 129296502
5-prop-1-en-2-yl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol (PubChem CID 129296502) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-prop-1-en-2-yl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol.
| Compound Name | 5-prop-1-en-2-yl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol |
|---|---|
| PubChem CID | 129296502 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 5-prop-1-en-2-yl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol |
| SMILES | C=C(C)C1CCc2nonc2C1O |
| InChI | InChI=1S/C9H12N2O2/c1-5(2)6-3-4-7-8(9(6)12)11-13-10-7/h6,9,12H,1,3-4H2,2H3 |
| InChIKey | BSYFBXMISMPXLS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|