C11H16N2O — CID 129296512
6-ethyl-2-methyl-5,6,7,8-tetrahydroquinazolin-5-ol (PubChem CID 129296512) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 6-ethyl-2-methyl-5,6,7,8-tetrahydroquinazolin-5-ol.
| Compound Name | 6-ethyl-2-methyl-5,6,7,8-tetrahydroquinazolin-5-ol |
|---|---|
| PubChem CID | 129296512 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 6-ethyl-2-methyl-5,6,7,8-tetrahydroquinazolin-5-ol |
| SMILES | CCC1CCc2nc(C)ncc2C1O |
| InChI | InChI=1S/C11H16N2O/c1-3-8-4-5-10-9(11(8)14)6-12-7(2)13-10/h6,8,11,14H,3-5H2,1-2H3 |
| InChIKey | QVMGTVYPEINMSK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |