About 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol
7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol (PubChem CID 129296532) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol.
Analyze 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol?
The IUPAC name of 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol (CID 129296532) is 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol.
What is the SMILES notation for 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol?
The canonical SMILES for 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol is CCC1CCn2cncc2C1O.
What is the InChIKey of 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol?
The InChIKey is WGQACZVWGHIABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-2-7-3-4-11-6-10-5-8(11)9(7)12/h5-7,9,12H,2-4H2,1H3.
What are the key properties of 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol?
7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol has a molecular weight of 166.22 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-ol is sourced from PubChem (CID 129296532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).