About 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole
5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole (PubChem CID 129296647) has the molecular formula C9H11FN2
and a molecular weight of 166.20 g/mol. Its IUPAC name is 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole.
Molecular Properties
| Compound Name | 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole |
| PubChem CID | 129296647 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole |
| SMILES | C=C(/C(F)=C\C)c1cncn1C |
| InChI | InChI=1S/C9H11FN2/c1-4-8(10)7(2)9-5-11-6-12(9)3/h4-6H,2H2,1,3H3/b8-4+ |
| InChIKey | AGPJICDLJLEVHC-XBXARRHUSA-N |
| XLogP | 2.31 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole?
The IUPAC name of 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole (CID 129296647) is 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole.
What is the SMILES notation for 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole?
The canonical SMILES for 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole is C=C(/C(F)=C\C)c1cncn1C.
What is the InChIKey of 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole?
The InChIKey is AGPJICDLJLEVHC-XBXARRHUSA-N. The full InChI is InChI=1S/C9H11FN2/c1-4-8(10)7(2)9-5-11-6-12(9)3/h4-6H,2H2,1,3H3/b8-4+.
What are the key properties of 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole?
5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole has a molecular weight of 166.20 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3E)-3-fluoropenta-1,3-dien-2-yl]-1-methylimidazole is sourced from PubChem (CID 129296647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).