About 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol
3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol (PubChem CID 129296731) has the molecular formula C7H9FN2O
and a molecular weight of 156.16 g/mol. Its IUPAC name is 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol.
Analyze 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol?
The IUPAC name of 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol (CID 129296731) is 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol.
What is the SMILES notation for 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol?
The canonical SMILES for 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol is OC1CCCn2ncc(F)c21.
What is the InChIKey of 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol?
The InChIKey is KRRCBGHVKPENCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2O/c8-5-4-9-10-3-1-2-6(11)7(5)10/h4,6,11H,1-3H2.
What are the key properties of 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol?
3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol has a molecular weight of 156.16 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-ol is sourced from PubChem (CID 129296731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).