About N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide
N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide (PubChem CID 129296896) has the molecular formula C10H11IN2
and a molecular weight of 286.12 g/mol. Its IUPAC name is N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide |
| PubChem CID | 129296896 |
| Molecular Formula | C10H11IN2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide |
| SMILES | C=C1C=C(I)C=C/C1=N\C(C)=N\C |
| InChI | InChI=1S/C10H11IN2/c1-7-6-9(11)4-5-10(7)13-8(2)12-3/h4-6H,1H2,2-3H3/b12-8+,13-10+ |
| InChIKey | MENRMYANWZUCCQ-SDCOAONHSA-N |
| XLogP | 2.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide?
The IUPAC name of N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide (CID 129296896) is N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide.
What is the SMILES notation for N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide?
The canonical SMILES for N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide is C=C1C=C(I)C=C/C1=N\C(C)=N\C.
What is the InChIKey of N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide?
The InChIKey is MENRMYANWZUCCQ-SDCOAONHSA-N. The full InChI is InChI=1S/C10H11IN2/c1-7-6-9(11)4-5-10(7)13-8(2)12-3/h4-6H,1H2,2-3H3/b12-8+,13-10+.
What are the key properties of N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide?
N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide has a molecular weight of 286.12 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-methylethanimidamide is sourced from PubChem (CID 129296896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).