C9H12N2OS — CID 129297022
6-(thiiran-2-yl)-4,5,6,7-tetrahydro-1H-indazol-7-ol (PubChem CID 129297022) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is 6-(thiiran-2-yl)-4,5,6,7-tetrahydro-1H-indazol-7-ol.
| Compound Name | 6-(thiiran-2-yl)-4,5,6,7-tetrahydro-1H-indazol-7-ol |
|---|---|
| PubChem CID | 129297022 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 6-(thiiran-2-yl)-4,5,6,7-tetrahydro-1H-indazol-7-ol |
| SMILES | OC1c2[nH]ncc2CCC1C1CS1 |
| InChI | InChI=1S/C9H12N2OS/c12-9-6(7-4-13-7)2-1-5-3-10-11-8(5)9/h3,6-7,9,12H,1-2,4H2,(H,10,11) |
| InChIKey | KUZNEDFNYYVWEI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|