C8H12N2O2 — CID 129297100
5-ethyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol (PubChem CID 129297100) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-ethyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol.
| Compound Name | 5-ethyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol |
|---|---|
| PubChem CID | 129297100 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 5-ethyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol |
| SMILES | CCC1CCc2nonc2C1O |
| InChI | InChI=1S/C8H12N2O2/c1-2-5-3-4-6-7(8(5)11)10-12-9-6/h5,8,11H,2-4H2,1H3 |
| InChIKey | VOELTAOECBKEDF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |