About 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol
5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol (PubChem CID 129297104) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol.
Analyze 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol?
The IUPAC name of 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol (CID 129297104) is 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol.
What is the SMILES notation for 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol?
The canonical SMILES for 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol is CC1CCc2nonc2C1O.
What is the InChIKey of 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol?
The InChIKey is FDXMOHNYUBHVSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4-2-3-5-6(7(4)10)9-11-8-5/h4,7,10H,2-3H2,1H3.
What are the key properties of 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol?
5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol has a molecular weight of 154.17 g/mol, XLogP of 0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,5,6,7-tetrahydro-2,1,3-benzoxadiazol-4-ol is sourced from PubChem (CID 129297104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).