About [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol
[(3S)-1,3-dimethylpyrrolidin-3-yl]methanol (PubChem CID 129297479) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol |
| PubChem CID | 129297479 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol |
| SMILES | CN1CC[C@](C)(CO)C1 |
| InChI | InChI=1S/C7H15NO/c1-7(6-9)3-4-8(2)5-7/h9H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | LSWLZQGMAHFPLN-ZETCQYMHSA-N |
| XLogP | 0.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol?
The IUPAC name of [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol (CID 129297479) is [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol?
The canonical SMILES for [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol is CN1CC[C@](C)(CO)C1.
What is the InChIKey of [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol?
The InChIKey is LSWLZQGMAHFPLN-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H15NO/c1-7(6-9)3-4-8(2)5-7/h9H,3-6H2,1-2H3/t7-/m0/s1.
What are the key properties of [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol?
[(3S)-1,3-dimethylpyrrolidin-3-yl]methanol has a molecular weight of 129.20 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1,3-dimethylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 129297479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).