C25H30N6O4 — CID 129297773
N-[4-formyl-5-[[methyl(oxan-4-yl)amino]methyl]-2-morpholin-4-ylphenyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 129297773) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[4-formyl-5-[[methyl(oxan-4-yl)amino]methyl]-2-morpholin-4-ylphenyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[4-formyl-5-[[methyl(oxan-4-yl)amino]methyl]-2-morpholin-4-ylphenyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 129297773 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | N-[4-formyl-5-[[methyl(oxan-4-yl)amino]methyl]-2-morpholin-4-ylphenyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CN(Cc1cc(NC(=O)c2cnn3cccnc23)c(N2CCOCC2)cc1C=O)C1CCOCC1 |
| InChI | InChI=1S/C25H30N6O4/c1-29(20-3-9-34-10-4-20)16-18-13-22(23(14-19(18)17-32)30-7-11-35-12-8-30)28-25(33)21-15-27-31-6-2-5-26-24(21)31/h2,5-6,13-15,17,20H,3-4,7-12,16H2,1H3,(H,28,33) |
| InChIKey | ZPWBPLPIWNUPRQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|