C8H10F8O2 — CID 12929800
1,1,2,2-tetrafluoro-3-[1-(2,2,3,3-tetrafluoropropoxy)ethoxy]propane (PubChem CID 12929800) has the molecular formula C8H10F8O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3-[1-(2,2,3,3-tetrafluoropropoxy)ethoxy]propane.
| Compound Name | 1,1,2,2-tetrafluoro-3-[1-(2,2,3,3-tetrafluoropropoxy)ethoxy]propane |
|---|---|
| PubChem CID | 12929800 |
| Molecular Formula | C8H10F8O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3-[1-(2,2,3,3-tetrafluoropropoxy)ethoxy]propane |
| SMILES | CC(OCC(F)(F)C(F)F)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H10F8O2/c1-4(17-2-7(13,14)5(9)10)18-3-8(15,16)6(11)12/h4-6H,2-3H2,1H3 |
| InChIKey | DJEDBFIVAIUCLI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|