About 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine
1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine (PubChem CID 129298241) has the molecular formula C13H15F3N2O2
and a molecular weight of 288.27 g/mol. Its IUPAC name is 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine.
Molecular Properties
| Compound Name | 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine |
| PubChem CID | 129298241 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine |
| SMILES | CONc1cc2c(cc1F)OC1(C2)CN(CC(F)F)C1 |
| InChI | InChI=1S/C13H15F3N2O2/c1-19-17-10-2-8-4-13(20-11(8)3-9(10)14)6-18(7-13)5-12(15)16/h2-3,12,17H,4-7H2,1H3 |
| InChIKey | WBAPMFZRQVYRDR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine?
The IUPAC name of 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine (CID 129298241) is 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine.
What is the SMILES notation for 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine?
The canonical SMILES for 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine is CONc1cc2c(cc1F)OC1(C2)CN(CC(F)F)C1.
What is the InChIKey of 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine?
The InChIKey is WBAPMFZRQVYRDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3N2O2/c1-19-17-10-2-8-4-13(20-11(8)3-9(10)14)6-18(7-13)5-12(15)16/h2-3,12,17H,4-7H2,1H3.
What are the key properties of 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine?
1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine has a molecular weight of 288.27 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(2,2-difluoroethyl)-6-fluoro-N-methoxyspiro[3H-1-benzofuran-2,3'-azetidine]-5-amine is sourced from PubChem (CID 129298241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).