About 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine
6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine (PubChem CID 129298396) has the molecular formula C14H18F2N2O2
and a molecular weight of 284.31 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine.
Molecular Properties
| Compound Name | 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine |
| PubChem CID | 129298396 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine |
| SMILES | Nc1cc2c(cc1OCC(F)F)OC1(CCNCC1)C2 |
| InChI | InChI=1S/C14H18F2N2O2/c15-13(16)8-19-12-6-11-9(5-10(12)17)7-14(20-11)1-3-18-4-2-14/h5-6,13,18H,1-4,7-8,17H2 |
| InChIKey | QOAJGDALFFRXLS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine?
The IUPAC name of 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine (CID 129298396) is 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine.
What is the SMILES notation for 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine?
The canonical SMILES for 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine is Nc1cc2c(cc1OCC(F)F)OC1(CCNCC1)C2.
What is the InChIKey of 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine?
The InChIKey is QOAJGDALFFRXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2N2O2/c15-13(16)8-19-12-6-11-9(5-10(12)17)7-14(20-11)1-3-18-4-2-14/h5-6,13,18H,1-4,7-8,17H2.
What are the key properties of 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine?
6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine has a molecular weight of 284.31 g/mol, XLogP of 1.97, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-difluoroethoxy)spiro[3H-1-benzofuran-2,4'-piperidine]-5-amine is sourced from PubChem (CID 129298396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).