C22H29N3 — CID 129298525
(2S)-2-ethenyl-N-(3-methanimidoylbuta-1,3-dien-2-yl)-2-methyl-6-piperidin-1-yl-1,3-dihydroinden-5-amine (PubChem CID 129298525) has the molecular formula C22H29N3 and a molecular weight of 335.50 g/mol. Its IUPAC name is (2S)-2-ethenyl-N-(3-methanimidoylbuta-1,3-dien-2-yl)-2-methyl-6-piperidin-1-yl-1,3-dihydroinden-5-amine.
| Compound Name | (2S)-2-ethenyl-N-(3-methanimidoylbuta-1,3-dien-2-yl)-2-methyl-6-piperidin-1-yl-1,3-dihydroinden-5-amine |
|---|---|
| PubChem CID | 129298525 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | (2S)-2-ethenyl-N-(3-methanimidoylbuta-1,3-dien-2-yl)-2-methyl-6-piperidin-1-yl-1,3-dihydroinden-5-amine |
| SMILES | [H]/N=C/C(=C)C(=C)Nc1cc2c(cc1N1CCCCC1)C[C@@](C)(C=C)C2 |
| InChI | InChI=1S/C22H29N3/c1-5-22(4)13-18-11-20(24-17(3)16(2)15-23)21(12-19(18)14-22)25-9-7-6-8-10-25/h5,11-12,15,23-24H,1-3,6-10,13-14H2,4H3/b23-15+/t22-/m0/s1 |
| InChIKey | HPBBVVSUWXZZPM-GQBVICOWSA-N |
| XLogP | 5.10 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|