About (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol
(2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol (PubChem CID 129298768) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol |
| PubChem CID | 129298768 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol |
| SMILES | CC(C)N1CCC([C@@](C)(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H20F3NO/c1-8(2)15-6-4-9(5-7-15)10(3,16)11(12,13)14/h8-9,16H,4-7H2,1-3H3/t10-/m1/s1 |
| InChIKey | MHHSZLOBKFSUQE-SNVBAGLBSA-N |
| XLogP | 2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol?
The IUPAC name of (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol (CID 129298768) is (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol.
What is the SMILES notation for (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol?
The canonical SMILES for (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol is CC(C)N1CCC([C@@](C)(O)C(F)(F)F)CC1.
What is the InChIKey of (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol?
The InChIKey is MHHSZLOBKFSUQE-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H20F3NO/c1-8(2)15-6-4-9(5-7-15)10(3,16)11(12,13)14/h8-9,16H,4-7H2,1-3H3/t10-/m1/s1.
What are the key properties of (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol?
(2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol has a molecular weight of 239.28 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1,1-trifluoro-2-(1-propan-2-ylpiperidin-4-yl)propan-2-ol is sourced from PubChem (CID 129298768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).